![5-[4′-[(2-Butyl-4,5-dichloro-1H-imidazol-1-yl)methyl][1,1′-biphenyl]-2-yl]-2H-tetrazole](https://static.cymitquimica.com/cas-image/269068-5-4-2-butyl-45-dichloro-1h-imidazol-1-yl-methyl-11-biphenyl-2-yl-2h-tetrazole.png)
CAS 1159977-26-0: 5-[4′-[(2-Butyl-4,5-dichloro-1H-imidazol-1-yl)methyl][1,1′-biphenyl]-2-yl]-2H-tetrazole
Description:5-[4′-[(2-Butyl-4,5-dichloro-1H-imidazol-1-yl)methyl][1,1′-biphenyl]-2-yl]-2H-tetrazole is a complex organic compound characterized by its unique structural features, which include a tetrazole ring and a biphenyl moiety. The presence of the 2-butyl group and dichloro substituents on the imidazole ring contributes to its chemical reactivity and potential biological activity. This compound may exhibit properties such as lipophilicity due to the butyl group, which can influence its solubility and permeability in biological systems. The tetrazole ring is known for its ability to participate in various chemical reactions, including coordination with metal ions and acting as a bioisostere for carboxylic acids in medicinal chemistry. Additionally, the presence of multiple aromatic systems suggests potential for π-π stacking interactions, which can be relevant in drug design and molecular recognition. Overall, this compound's intricate structure may confer specific pharmacological properties, making it of interest in fields such as medicinal chemistry and material science.
Formula:C21H20Cl2N6
InChI:InChI=1S/C21H20Cl2N6/c1-2-3-8-18-24-19(22)20(23)29(18)13-14-9-11-15(12-10-14)16-6-4-5-7-17(16)21-25-27-28-26-21/h4-7,9-12H,2-3,8,13H2,1H3,(H,25,26,27,28)
InChI key:InChIKey=KUSIPNNIJUARFJ-UHFFFAOYSA-N
SMILES:ClC=1N=C(N(C1Cl)CC=2C=CC(=CC2)C=3C=CC=CC3C4=NN=NN4)CCCC
| Brand | Product data | Purity | Price range | Estimated delivery |
|---|---|---|---|---|
 | Losartan Impurity 23 REF: 4Z-L-1111CAS: 1159977-26-0 | - - - | To inquire | Mon 03 Mar 25 |
 | 5-Deshydroxymethyl-5-chloro Losartan (Losartan Impurity K) REF: TR-D290015CAS: 1159977-26-0 | - - - | 2,320.00 € | Mon 14 Apr 25 |
 | 5-Deshydroxymethyl-5-chloro losartan (losartan impurity K) REF: 3D-JWB97726CAS: 1159977-26-0 | Min. 95% | - - - | Discontinued product |
Losartan Impurity 23
Ref: 4Z-L-1111
| 5mg | To inquire | ||
| 10mg | To inquire | ||
| 25mg | To inquire | ||
| 50mg | To inquire | ||
| 100mg | To inquire |
5-Deshydroxymethyl-5-chloro Losartan (Losartan Impurity K)
Controlled ProductRef: TR-D290015
| 100mg | 2,320.00 € |
5-Deshydroxymethyl-5-chloro losartan (losartan impurity K)
Ref: 3D-JWB97726
| 5mg | Discontinued | Request information | |
| 10mg | Discontinued | Request information | |
| 25mg | Discontinued | Request information | |
| 50mg | Discontinued | Request information | |
| 100mg | Discontinued | Request information |
