CAS 1159977-28-2
:Phenylmethyl 3-hydroxy-4,5-bis(phenylmethoxy)benzoate
Description:
Phenylmethyl 3-hydroxy-4,5-bis(phenylmethoxy)benzoate, identified by its CAS number 1159977-28-2, is an organic compound characterized by its complex structure, which includes a benzoate moiety substituted with multiple phenylmethoxy groups. This compound typically exhibits properties associated with esters, such as moderate solubility in organic solvents and potential hydrophobic characteristics due to the presence of phenyl groups. The hydroxyl group in its structure may contribute to hydrogen bonding, influencing its solubility and reactivity. Additionally, the presence of multiple aromatic rings suggests that it may exhibit significant UV absorbance, making it potentially useful in applications such as UV filters or stabilizers in various formulations. The compound's intricate structure may also impart unique biological activities, which could be of interest in pharmaceutical or agrochemical research. Overall, its properties and potential applications are likely influenced by its molecular architecture, making it a subject of interest in both synthetic and applied chemistry.
Formula:C28H24O5
InChI:InChI=1S/C28H24O5/c29-25-16-24(28(30)33-20-23-14-8-3-9-15-23)17-26(31-18-21-10-4-1-5-11-21)27(25)32-19-22-12-6-2-7-13-22/h1-17,29H,18-20H2
InChI key:InChIKey=FYKMZXGMRCGQKQ-UHFFFAOYSA-N
SMILES:O(CC1=CC=CC=C1)C2=C(OCC3=CC=CC=C3)C=C(C(OCC4=CC=CC=C4)=O)C=C2O
Synonyms:- Phenylmethyl 3-hydroxy-4,5-bis(phenylmethoxy)benzoate
- Benzoic acid, 3-hydroxy-4,5-bis(phenylmethoxy)-, phenylmethyl ester
- Benzyl 3,4-Dibenzyloxy-5-hydroxy Benzoate
- 3-Hydroxy-4,5-bis(phenylMethoxy)benzoic Acid PhenylMethyl Ester
- 3,4-DiphenylMethoxy-5-hydroxy-benzoic Acid Benzyl Ester
- 3,4-Dibenzyl-gallic Acid Benzyl Ester
- Benzyl 3,4-Di-O-benzyl-5-hydroxy Benzoate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
3,4-Dibenzyl-gallic Acid Benzyl Ester
CAS:Controlled Product<p>Applications An intermediate in the preparation of Digallic Acid<br></p>Formula:C28H24O5Color and Shape:NeatMolecular weight:440.49
