CAS 1159977-37-3
:[1,1′-Biphenyl]-4-acetic acid, 2-fluoro-α-methyl-, anhydride with sulfuric acid (1:1)
Description:
[1,1′-Biphenyl]-4-acetic acid, 2-fluoro-α-methyl-, anhydride with sulfuric acid (1:1) is a chemical compound characterized by its biphenyl structure, which consists of two phenyl rings connected by a single bond. The presence of a 2-fluoro-α-methyl group indicates that there is a fluorine atom and a methyl group attached to the alpha position of the acetic acid moiety. This compound is likely to exhibit properties typical of both biphenyl derivatives and carboxylic acid anhydrides, including potential reactivity due to the anhydride functional group. The inclusion of sulfuric acid suggests that this compound may be involved in acid-catalyzed reactions or serve as a dehydrating agent. Its molecular structure may impart specific solubility characteristics, stability under certain conditions, and potential applications in organic synthesis or as an intermediate in chemical manufacturing. Safety data and handling precautions should be considered due to the presence of sulfuric acid and the potential reactivity of the anhydride.
Formula:C15H13FO5S
InChI:InChI=1S/C15H13FO5S/c1-10(15(17)21-22(18,19)20)12-7-8-13(14(16)9-12)11-5-3-2-4-6-11/h2-10H,1H3,(H,18,19,20)
InChI key:InChIKey=MTGSLULZVAGEDI-UHFFFAOYSA-N
SMILES:FC1=C(C=CC(C(C(OS(=O)(=O)O)=O)C)=C1)C2=CC=CC=C2
Synonyms:- [1,1′-Biphenyl]-4-acetic acid, 2-fluoro-α-methyl-, anhydride with sulfuric acid (1:1)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
