CAS 1159977-41-9

[6-(Hydroxymethyl)-4-methoxy-5-methyl-3-pyridinyl]methyl 2-methylbenzoate

Description:

The chemical substance known as [6-(Hydroxymethyl)-4-methoxy-5-methyl-3-pyridinyl]methyl 2-methylbenzoate, with the CAS number 1159977-41-9, is a complex organic compound characterized by its pyridine and benzoate functional groups. It features a pyridine ring substituted with hydroxymethyl, methoxy, and methyl groups, which contribute to its unique chemical properties and potential biological activity. The presence of the benzoate moiety suggests that it may exhibit ester-like characteristics, influencing its solubility and reactivity. This compound may be of interest in medicinal chemistry due to its structural features, which could interact with biological targets. Additionally, the hydroxymethyl and methoxy groups can participate in hydrogen bonding and other intermolecular interactions, potentially affecting its pharmacokinetics and pharmacodynamics. Overall, the compound's structural complexity and functional groups indicate that it may have applications in drug development or as a chemical intermediate in synthetic organic chemistry. Further studies would be necessary to elucidate its specific properties and potential uses.

Formula: C₁₇H₁₉NO₄

InChI: InChI=1S/C17H19NO4/c1-11-6-4-5-7-14(11)17(20)22-10-13-8-18-15(9-19)12(2)16(13)21-3/h4-8,19H,9-10H2,1-3H3

InChI key: InChIKey=GCCIRXSHKXMPJL-UHFFFAOYSA-N

SMILES: C(OC(=O)C1=C(C)C=CC=C1)C=2C(OC)=C(C)C(CO)=NC2

Synonyms:

• Benzoic acid, 2-methyl-, [6-(hydroxymethyl)-4-methoxy-5-methyl-3-pyridinyl]methyl ester
• [6-(Hydroxymethyl)-4-methoxy-5-methyl-3-pyridinyl]methyl 2-methylbenzoate