CymitQuimica logo

CAS 1159977-46-4

:

5-Chloro-N-[[3-[4-(3-hydroxy-5-oxo-4-morpholinyl)phenyl]-2-oxo-5-oxazolidinyl]methyl]-2-thiophenecarboxamide

Description:
5-Chloro-N-[[3-[4-(3-hydroxy-5-oxo-4-morpholinyl)phenyl]-2-oxo-5-oxazolidinyl]methyl]-2-thiophenecarboxamide is a complex organic compound characterized by its multi-functional structure, which includes a thiophene ring, an oxazolidinone moiety, and a morpholine group. The presence of a chloro substituent indicates potential reactivity and influences its chemical properties. This compound may exhibit biological activity, potentially serving as a pharmaceutical agent, given its structural features that are often associated with medicinal chemistry. The hydroxyl and carbonyl groups contribute to its polar characteristics, which can affect solubility and interaction with biological targets. Additionally, the compound's molecular structure suggests it may participate in hydrogen bonding and other intermolecular interactions, which are crucial for its efficacy in biological systems. Overall, the characteristics of this compound make it a subject of interest in drug development and chemical research, particularly in the context of its potential therapeutic applications.
Formula:C19H18ClN3O6S
InChI:InChI=1S/C19H18ClN3O6S/c20-15-6-5-14(30-15)18(26)21-7-13-8-22(19(27)29-13)11-1-3-12(4-2-11)23-16(24)9-28-10-17(23)25/h1-6,13,16,24H,7-10H2,(H,21,26)
InChI key:InChIKey=DZZZOMQJUMULNY-UHFFFAOYSA-N
SMILES:O=C1N(CC(CNC(=O)C=2SC(Cl)=CC2)O1)C3=CC=C(C=C3)N4C(O)COCC4=O
Synonyms:
  • 5-Chloro-N-[[3-[4-(3-hydroxy-5-oxo-4-morpholinyl)phenyl]-2-oxo-5-oxazolidinyl]methyl]-2-thiophenecarboxamide
  • 2-Thiophenecarboxamide, 5-chloro-N-[[3-[4-(3-hydroxy-5-oxo-4-morpholinyl)phenyl]-2-oxo-5-oxazolidinyl]methyl]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.