CymitQuimica logo

CAS 1159977-49-7

:

2-Pyridineethanol, 5-(2-methyl-1,3-dioxolan-2-yl)-, 2-acetate

Description:
2-Pyridineethanol, 5-(2-methyl-1,3-dioxolan-2-yl)-, 2-acetate, identified by its CAS number 1159977-49-7, is a chemical compound that features a pyridine ring substituted with an ethanol group and an acetate moiety. This compound exhibits characteristics typical of both pyridine derivatives and acetates, including potential solubility in polar solvents due to the presence of hydroxyl and acetate functional groups. The dioxolane ring contributes to its cyclic structure, which may influence its reactivity and stability. Generally, compounds of this nature can exhibit biological activity, making them of interest in medicinal chemistry. The presence of the pyridine nitrogen may also impart basicity, affecting its interaction with other chemical species. Additionally, the compound's molecular structure suggests potential applications in organic synthesis or as intermediates in the production of pharmaceuticals. However, specific physical properties such as boiling point, melting point, and solubility would require empirical data for precise characterization.
Formula:C13H17NO4
InChI:InChI=1S/C13H17NO4/c1-10(15)16-6-5-12-4-3-11(9-14-12)13(2)17-7-8-18-13/h3-4,9H,5-8H2,1-2H3
InChI key:InChIKey=WPTZWMHTKZOJSE-UHFFFAOYSA-N
SMILES:CC1(C=2C=CC(CCOC(C)=O)=NC2)OCCO1
Synonyms:
  • 2-Pyridineethanol, 5-(2-methyl-1,3-dioxolan-2-yl)-, 2-acetate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.