CAS 1159977-61-3
:N-[4-Chloro-2-(2,2,2-trifluoroacetyl)-5-[[tris(1-methylethyl)silyl]oxy]phenyl]-2,2-dimethylpropanamide
Description:
N-[4-Chloro-2-(2,2,2-trifluoroacetyl)-5-[[tris(1-methylethyl)silyl]oxy]phenyl]-2,2-dimethylpropanamide is a synthetic organic compound characterized by its complex structure, which includes a chloro-substituted phenyl ring, a trifluoroacetyl group, and a silyl ether moiety. The presence of the trifluoroacetyl group imparts unique electronic properties, enhancing its reactivity and potential applications in various chemical reactions. The tris(1-methylethyl)silyl group contributes to the compound's hydrophobic characteristics and may influence its solubility and stability in different solvents. This compound is likely to exhibit significant biological activity due to its structural features, making it of interest in pharmaceutical research. Additionally, the presence of multiple functional groups suggests potential for diverse reactivity, including nucleophilic substitutions and coupling reactions. Overall, this compound's unique combination of functional groups and substituents positions it as a valuable candidate for further study in medicinal chemistry and materials science.
Formula:C22H33ClF3NO3Si
InChI:InChI=1S/C22H33ClF3NO3Si/c1-12(2)31(13(3)4,14(5)6)30-18-11-17(27-20(29)21(7,8)9)15(10-16(18)23)19(28)22(24,25)26/h10-14H,1-9H3,(H,27,29)
InChI key:InChIKey=SILAOMZQAFDXMP-UHFFFAOYSA-N
SMILES:[Si](OC1=CC(NC(C(C)(C)C)=O)=C(C(C(F)(F)F)=O)C=C1Cl)(C(C)C)(C(C)C)C(C)C
Synonyms:- N-[4-Chloro-2-(2,2,2-trifluoroacetyl)-5-[[tris(1-methylethyl)silyl]oxy]phenyl]-2,2-dimethylpropanamide
- Propanamide, N-[4-chloro-2-(2,2,2-trifluoroacetyl)-5-[[tris(1-methylethyl)silyl]oxy]phenyl]-2,2-dimethyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.