CymitQuimica logo

CAS 1159978-69-4

:

1-(4-Bromo-2-hydroxyphenyl)-3-(diethylamino)-2-propen-1-one

Description:
1-(4-Bromo-2-hydroxyphenyl)-3-(diethylamino)-2-propen-1-one, also known by its CAS number 1159978-69-4, is an organic compound characterized by its unique structural features. It contains a propenone backbone, which is a conjugated system that contributes to its potential reactivity and stability. The presence of a bromine atom and a hydroxyl group on the phenyl ring enhances its electrophilic properties, making it a candidate for various chemical reactions. The diethylamino group introduces basicity and can influence the compound's solubility and interaction with biological systems. This compound may exhibit interesting photophysical properties due to its conjugated structure, which can be relevant in applications such as dye synthesis or as a potential pharmaceutical agent. Additionally, the presence of both electron-donating and electron-withdrawing groups suggests that it may participate in diverse chemical transformations, making it a subject of interest in synthetic organic chemistry and medicinal chemistry research.
Formula:C13H16BrNO2
InChI:InChI=1S/C13H16BrNO2/c1-3-15(4-2)8-7-12(16)11-6-5-10(14)9-13(11)17/h5-9,17H,3-4H2,1-2H3
InChI key:InChIKey=SAHQZEHXJHKPIS-UHFFFAOYSA-N
SMILES:C(C=CN(CC)CC)(=O)C1=C(O)C=C(Br)C=C1
Synonyms:
  • 2-Propen-1-one, 1-(4-bromo-2-hydroxyphenyl)-3-(diethylamino)-
  • 1-(4-Bromo-2-hydroxyphenyl)-3-(diethylamino)-2-propen-1-one
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.