CAS 1159978-71-8

7-Fluoro-4-oxo-4H-1-benzopyran-3-carbonitrile

Description:

7-Fluoro-4-oxo-4H-1-benzopyran-3-carbonitrile is a synthetic organic compound characterized by its unique structural features, which include a benzopyran core, a fluorine substituent, and a cyano group. The presence of the fluorine atom typically enhances the compound's lipophilicity and may influence its biological activity, making it of interest in medicinal chemistry. The carbonitrile functional group contributes to the compound's reactivity and potential applications in various chemical reactions, including nucleophilic additions. The oxo group indicates the presence of a carbonyl, which can participate in further chemical transformations. This compound may exhibit interesting pharmacological properties, potentially acting as an inhibitor or modulator in biological systems. Its specific applications and efficacy would depend on further studies, including in vitro and in vivo evaluations. Overall, 7-Fluoro-4-oxo-4H-1-benzopyran-3-carbonitrile represents a class of compounds that could be explored for their therapeutic potential, particularly in the fields of medicinal chemistry and drug development.

Formula: C₁₀H₄FNO₂

InChI: InChI=1S/C10H4FNO2/c11-7-1-2-8-9(3-7)14-5-6(4-12)10(8)13/h1-3,5H

InChI key: InChIKey=KLAUVWFIZOLROQ-UHFFFAOYSA-N

SMILES: O=C1C=2C(OC=C1C#N)=CC(F)=CC2

Synonyms:

• 7-Fluoro-4-oxo-4H-1-benzopyran-3-carbonitrile
• 4H-1-Benzopyran-3-carbonitrile, 7-fluoro-4-oxo-
• 7-Fluoro-4-oxo-4H-chromene-3-carbonitrile