CAS 1159978-72-9
:3-(Diethylamino)-1-(4-fluoro-2-hydroxyphenyl)-2-propen-1-one
Description:
3-(Diethylamino)-1-(4-fluoro-2-hydroxyphenyl)-2-propen-1-one, identified by its CAS number 1159978-72-9, is an organic compound characterized by its unique structural features. It contains a propenone backbone, which is a conjugated system that contributes to its potential reactivity and stability. The presence of a diethylamino group enhances its basicity and solubility in organic solvents, while the 4-fluoro-2-hydroxyphenyl moiety introduces both electron-withdrawing and electron-donating characteristics, influencing its electronic properties and reactivity. This compound may exhibit biological activity due to its structural motifs, making it of interest in medicinal chemistry and drug development. Additionally, the hydroxyl group can participate in hydrogen bonding, affecting its interactions with other molecules. Overall, the combination of these functional groups suggests that this compound could have diverse applications, particularly in the fields of pharmaceuticals and organic synthesis. However, specific properties such as melting point, boiling point, and solubility would require empirical data for precise characterization.
Formula:C13H16FNO2
InChI:InChI=1S/C13H16FNO2/c1-3-15(4-2)8-7-12(16)11-6-5-10(14)9-13(11)17/h5-9,17H,3-4H2,1-2H3
InChI key:InChIKey=XRYNSJASQNNEIG-UHFFFAOYSA-N
SMILES:C(C=CN(CC)CC)(=O)C1=C(O)C=C(F)C=C1
Synonyms:- 2-Propen-1-one, 3-(diethylamino)-1-(4-fluoro-2-hydroxyphenyl)-
- 3-(Diethylamino)-1-(4-fluoro-2-hydroxyphenyl)-2-propen-1-one
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.