CymitQuimica logo

CAS 1159979-41-5

:

3-(4-Methoxyphenyl)-5-isoxazoleethanol

Description:
3-(4-Methoxyphenyl)-5-isoxazoleethanol, identified by its CAS number 1159979-41-5, is a chemical compound that features a unique structure combining an isoxazole ring with a phenolic group. This compound typically exhibits characteristics such as moderate solubility in organic solvents and potential bioactivity due to the presence of the isoxazole moiety, which is known for its role in various pharmacological activities. The methoxy group on the phenyl ring can influence the compound's electronic properties and steric hindrance, potentially affecting its reactivity and interaction with biological targets. Additionally, the hydroxyl group in the ethanol part of the molecule may contribute to hydrogen bonding capabilities, enhancing its solubility in polar solvents. Overall, this compound may be of interest in medicinal chemistry and drug development, particularly in the context of exploring its therapeutic potential and mechanisms of action. Further studies would be necessary to fully elucidate its properties and applications.
Formula:C12H13NO3
InChI:InChI=1S/C12H13NO3/c1-15-10-4-2-9(3-5-10)12-8-11(6-7-14)16-13-12/h2-5,8,14H,6-7H2,1H3
InChI key:InChIKey=ORUSLGHVDPEHLG-UHFFFAOYSA-N
SMILES:C(CO)C1=CC(=NO1)C2=CC=C(OC)C=C2
Synonyms:
  • 2-[3-(4-Methoxyphenyl)-1,2-oxazol-5-yl]ethan-1-ol
  • 5-Isoxazoleethanol, 3-(4-methoxyphenyl)-
  • 3-(4-Methoxyphenyl)-5-isoxazoleethanol
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.