CAS 1159979-56-2

Ethyl 5-amino-1-(3-chlorophenyl)-1H-imidazole-4-carboxylate

Description:

Ethyl 5-amino-1-(3-chlorophenyl)-1H-imidazole-4-carboxylate is a chemical compound characterized by its imidazole ring, which is a five-membered heterocyclic structure containing two nitrogen atoms. This compound features an ethyl ester functional group, contributing to its solubility and reactivity. The presence of a 3-chlorophenyl group indicates that it has a chlorine substituent on the aromatic ring, which can influence its biological activity and chemical properties. The amino group at the 5-position of the imidazole ring suggests potential for hydrogen bonding and reactivity in various chemical reactions. This compound may be of interest in medicinal chemistry due to its structural features, which could impart specific pharmacological properties. Additionally, the carboxylate group enhances its potential for interactions with biological targets. Overall, the combination of these functional groups makes Ethyl 5-amino-1-(3-chlorophenyl)-1H-imidazole-4-carboxylate a compound of interest for further research in drug development and related fields.

Formula: C₁₂H₁₂ClN₃O₂

InChI: InChI=1S/C12H12ClN3O2/c1-2-18-12(17)10-11(14)16(7-15-10)9-5-3-4-8(13)6-9/h3-7H,2,14H2,1H3

InChI key: InChIKey=FTABDEIMYRNABY-UHFFFAOYSA-N

SMILES: NC=1N(C=NC1C(OCC)=O)C2=CC(Cl)=CC=C2

Synonyms:

• Ethyl 5-amino-1-(3-chlorophenyl)-1H-imidazole-4-carboxylate
• 1H-Imidazole-4-carboxylic acid, 5-amino-1-(3-chlorophenyl)-, ethyl ester