CAS 1159981-17-5

3-(4-Bromophenyl)-5-methyl-4-isoxazolemethanol

Description:

3-(4-Bromophenyl)-5-methyl-4-isoxazolemethanol is a chemical compound characterized by its isoxazole ring structure, which is a five-membered heterocyclic compound containing both nitrogen and oxygen. The presence of the 4-bromophenyl group indicates that there is a bromine atom attached to a phenyl ring at the para position, contributing to the compound's potential reactivity and biological activity. The methyl group at the 5-position of the isoxazole ring adds to the compound's hydrophobic characteristics, which can influence its solubility and interaction with biological systems. The hydroxymethyl group at the 4-position enhances the compound's polarity and may participate in hydrogen bonding, affecting its pharmacological properties. Overall, this compound may exhibit interesting chemical behavior and potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to its unique structural features. However, specific properties such as melting point, boiling point, and solubility would require empirical data for precise characterization.

Formula: C₁₁H₁₀BrNO₂

InChI: InChI=1S/C11H10BrNO2/c1-7-10(6-14)11(13-15-7)8-2-4-9(12)5-3-8/h2-5,14H,6H2,1H3

InChI key: InChIKey=CLMXHCRMTIJBOM-UHFFFAOYSA-N

SMILES: C(O)C=1C(=NOC1C)C2=CC=C(Br)C=C2

Synonyms:

• 4-Isoxazolemethanol, 3-(4-bromophenyl)-5-methyl-
• (3-(4-Bromophenyl)-5-methylisoxazol-4-yl)methanol
• 3-(4-Bromophenyl)-5-methyl-4-isoxazolemethanol