CAS 1159981-27-7

Methyl 3-amino-5-[4-(4-methoxyphenoxy)phenyl]-2-thiophenecarboxylate

Description:

Methyl 3-amino-5-[4-(4-methoxyphenoxy)phenyl]-2-thiophenecarboxylate, with the CAS number 1159981-27-7, is a synthetic organic compound characterized by its complex molecular structure, which includes a thiophene ring, an amino group, and a methoxyphenyl moiety. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, such as moderate solubility in organic solvents and potential reactivity due to the presence of functional groups. The thiophene ring contributes to its electronic properties, potentially allowing for interactions in biological systems or applications in materials science. The methoxy group may enhance lipophilicity, influencing its bioavailability and interaction with biological targets. Additionally, the presence of the amino group suggests potential for hydrogen bonding, which can affect its solubility and reactivity. Overall, this compound may be of interest in medicinal chemistry and material science due to its unique structural features and potential biological activities.

Formula: C₁₉H₁₇NO₄S

InChI: InChI=1S/C19H17NO4S/c1-22-13-7-9-15(10-8-13)24-14-5-3-12(4-6-14)17-11-16(20)18(25-17)19(21)23-2/h3-11H,20H2,1-2H3

InChI key: InChIKey=TWPDWTIWTGEZPY-UHFFFAOYSA-N

SMILES: C(OC)(=O)C=1SC(=CC1N)C2=CC=C(OC3=CC=C(OC)C=C3)C=C2