CAS 1159981-74-4
:4-Bromo-5-(4-methoxyphenyl)isoxazole
Description:
4-Bromo-5-(4-methoxyphenyl)isoxazole is an organic compound characterized by its isoxazole ring, which is a five-membered heterocyclic structure containing both nitrogen and oxygen. The presence of a bromine atom at the 4-position and a para-methoxyphenyl group at the 5-position contributes to its unique chemical properties. This compound is typically a solid at room temperature and may exhibit moderate solubility in organic solvents due to its aromatic character. Its molecular structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, as isoxazole derivatives are often investigated for their biological activities. The methoxy group can enhance lipophilicity, potentially influencing the compound's interaction with biological targets. Additionally, the bromine substituent may participate in various chemical reactions, including nucleophilic substitutions or coupling reactions, making it a versatile intermediate in organic synthesis. Overall, 4-Bromo-5-(4-methoxyphenyl)isoxazole is a compound of interest for further research in both synthetic and medicinal chemistry.
Formula:C10H8BrNO2
InChI:InChI=1S/C10H8BrNO2/c1-13-8-4-2-7(3-5-8)10-9(11)6-12-14-10/h2-6H,1H3
InChI key:InChIKey=QGCPEXJUIYVNPL-UHFFFAOYSA-N
SMILES:BrC1=C(C2=CC=C(OC)C=C2)ON=C1
Synonyms:- Isoxazole, 4-bromo-5-(4-methoxyphenyl)-
- 4-Bromo-5-(4-methoxyphenyl)isoxazole
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.