CAS 1159982-19-0

3-Iodo-1H-pyrrolo[2,3-b]pyridine-4-carboxaldehyde

Description:

3-Iodo-1H-pyrrolo[2,3-b]pyridine-4-carboxaldehyde is a heterocyclic organic compound characterized by its unique pyrrole and pyridine ring structure, which contributes to its potential biological activity. The presence of an iodine atom at the 3-position enhances its reactivity and may influence its pharmacological properties. The aldehyde functional group at the 4-position is significant for various chemical reactions, including condensation and nucleophilic addition, making it a versatile intermediate in organic synthesis. This compound is typically used in medicinal chemistry and research due to its potential applications in drug development, particularly in targeting specific biological pathways. Its molecular structure allows for interactions with various biological targets, which can be explored for therapeutic purposes. Additionally, the compound's solubility and stability in different solvents can vary, influencing its handling and application in laboratory settings. As with many halogenated compounds, safety precautions should be taken due to potential toxicity and environmental impact.

Formula: C₈H₅IN₂O

InChI: InChI=1S/C8H5IN2O/c9-6-3-11-8-7(6)5(4-12)1-2-10-8/h1-4H,(H,10,11)

InChI key: InChIKey=RHEXEMPHLJQWRH-UHFFFAOYSA-N

SMILES: C(=O)C1=C2C(NC=C2I)=NC=C1

Synonyms:

• 3-Iodo-1H-pyrrolo[2,3-b]pyridine-4-carboxaldehyde
• 1H-Pyrrolo[2,3-b]pyridine-4-carboxaldehyde, 3-iodo-

1H-Pyrrolo[2,3-b]pyridine-4-carboxaldehyde, 3-iodo-

CAS: 1159982-19-0

Formula: C₈H₅IN₂O

Molecular weight: 272.0426

Ref: IN-DA000HEC