CAS 1159982-25-8

Phenylmethyl 3-(methylamino)-1-piperidinecarboxylate

Description:

Phenylmethyl 3-(methylamino)-1-piperidinecarboxylate, identified by its CAS number 1159982-25-8, is a chemical compound that belongs to the class of piperidine derivatives. This substance typically exhibits characteristics such as being a white to off-white solid, with a moderate solubility in organic solvents and limited solubility in water. Its molecular structure features a piperidine ring, which contributes to its potential biological activity, particularly in pharmacological applications. The presence of the methylamino group suggests that it may interact with neurotransmitter systems, potentially influencing central nervous system activity. Additionally, the phenylmethyl group may enhance lipophilicity, affecting its absorption and distribution in biological systems. As with many piperidine derivatives, it may be of interest in medicinal chemistry for its potential therapeutic effects, although specific biological activities and safety profiles would require further investigation through empirical studies. Proper handling and safety measures should be observed, as with all chemical substances, due to potential toxicity or reactivity.

Formula: C₁₄H₂₀N₂O₂

InChI: InChI=1S/C14H20N2O2/c1-15-13-8-5-9-16(10-13)14(17)18-11-12-6-3-2-4-7-12/h2-4,6-7,13,15H,5,8-11H2,1H3

InChI key: InChIKey=NTHKMYRCEUJLOL-UHFFFAOYSA-N

SMILES: C(OCC1=CC=CC=C1)(=O)N2CC(NC)CCC2

Synonyms:

• 1-Piperidinecarboxylic acid, 3-(methylamino)-, phenylmethyl ester
• Phenylmethyl 3-(methylamino)-1-piperidinecarboxylate