CAS 1159982-28-1

1,1-Dimethylethyl 3-(2-pyridinylthio)-1-piperidinecarboxylate

Description:

1,1-Dimethylethyl 3-(2-pyridinylthio)-1-piperidinecarboxylate, identified by its CAS number 1159982-28-1, is a chemical compound that features a piperidine ring, which is a six-membered nitrogen-containing heterocycle. This compound is characterized by the presence of a dimethyl group attached to a tertiary carbon, contributing to its steric bulk. The inclusion of a pyridinylthio group indicates that it has a sulfur atom bonded to a pyridine ring, which can influence its reactivity and potential biological activity. The carboxylate functional group suggests that it may participate in various chemical reactions, including esterification and nucleophilic substitution. This compound may exhibit properties relevant to medicinal chemistry, particularly in the development of pharmaceuticals, due to the presence of the piperidine and pyridine moieties, which are common in bioactive compounds. Its solubility, stability, and reactivity would depend on the specific conditions and solvents used in experiments or applications. Overall, this compound's unique structure may provide interesting avenues for research and development in chemical and pharmaceutical fields.

Formula: C₁₅H₂₂N₂O₂S

InChI: InChI=1S/C15H22N2O2S/c1-15(2,3)19-14(18)17-10-6-7-12(11-17)20-13-8-4-5-9-16-13/h4-5,8-9,12H,6-7,10-11H2,1-3H3

InChI key: InChIKey=GPNFYXYTEJVSDQ-UHFFFAOYSA-N

SMILES: S(C1CN(C(OC(C)(C)C)=O)CCC1)C2=CC=CC=N2

Synonyms:

• 1-Piperidinecarboxylic acid, 3-(2-pyridinylthio)-, 1,1-dimethylethyl ester
• 1,1-Dimethylethyl 3-(2-pyridinylthio)-1-piperidinecarboxylate