CymitQuimica logo

CAS 1159982-59-8

:

1,1-Dimethylethyl 9-(phenylmethyl)-2,9-diazaspiro[5.5]undecane-2-carboxylate

Description:
1,1-Dimethylethyl 9-(phenylmethyl)-2,9-diazaspiro[5.5]undecane-2-carboxylate is a complex organic compound characterized by its unique spirocyclic structure, which includes a diaza (two nitrogen atoms) framework and a carboxylate functional group. The presence of the 1,1-dimethylethyl group contributes to its steric bulk, potentially influencing its reactivity and interactions with other molecules. The phenylmethyl substituent adds aromatic characteristics, which may enhance the compound's stability and solubility in organic solvents. This compound may exhibit interesting biological activities due to its structural features, making it a candidate for further pharmacological studies. Its synthesis and characterization would typically involve standard organic chemistry techniques, including NMR and mass spectrometry for structural confirmation. As with many organic compounds, its properties such as melting point, boiling point, and solubility would depend on the specific conditions and purity of the sample. Overall, this compound represents a fascinating area of study within the realm of organic and medicinal chemistry.
Formula:C21H32N2O2
InChI:InChI=1S/C21H32N2O2/c1-20(2,3)25-19(24)23-13-7-10-21(17-23)11-14-22(15-12-21)16-18-8-5-4-6-9-18/h4-6,8-9H,7,10-17H2,1-3H3
InChI key:InChIKey=PGZROCDJHYQOFI-UHFFFAOYSA-N
SMILES:C(OC(C)(C)C)(=O)N1CC2(CCN(CC3=CC=CC=C3)CC2)CCC1
Synonyms:
  • 1,1-Dimethylethyl 9-(phenylmethyl)-2,9-diazaspiro[5.5]undecane-2-carboxylate
  • 2,9-Diazaspiro[5.5]undecane-2-carboxylic acid, 9-(phenylmethyl)-, 1,1-dimethylethyl ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.