CAS 1159983-05-7

Pyrazolo[1,5-a]pyrimidine-2-acetic acid

Description:

Pyrazolo[1,5-a]pyrimidine-2-acetic acid is a heterocyclic compound characterized by its unique bicyclic structure, which incorporates both pyrazole and pyrimidine rings. This compound features an acetic acid functional group, contributing to its potential as a bioactive molecule. It is typically a solid at room temperature and may exhibit moderate solubility in polar solvents due to the presence of the carboxylic acid group. The compound is of interest in medicinal chemistry, particularly for its potential pharmacological properties, which may include anti-inflammatory or analgesic effects. Its molecular structure allows for various interactions with biological targets, making it a candidate for further research in drug development. Additionally, the presence of nitrogen atoms in the rings can influence its reactivity and stability, as well as its ability to form hydrogen bonds. Overall, Pyrazolo[1,5-a]pyrimidine-2-acetic acid represents a class of compounds that are valuable in the exploration of new therapeutic agents.

Formula: C₈H₇N₃O₂

InChI: InChI=1S/C8H7N3O2/c12-8(13)5-6-4-7-9-2-1-3-11(7)10-6/h1-4H,5H2,(H,12,13)

InChI key: InChIKey=UXBQTMKXMFVQIO-UHFFFAOYSA-N

SMILES: C(C(O)=O)C=1C=C2N(N1)C=CC=N2

Synonyms:

• Pyrazolo[1,5-a]pyrimidine-2-acetic acid
• 2-[Pyrazolo[1,5-a]pyrimidin-2-yl]acetic acid