CymitQuimica logo

CAS 1159983-78-4

:

4,4-Difluoro-1-propylpiperidine

Description:
4,4-Difluoro-1-propylpiperidine is a chemical compound characterized by its piperidine ring structure, which is a six-membered saturated nitrogen-containing heterocycle. The presence of two fluorine atoms at the 4-position of the piperidine ring significantly influences its chemical properties, including its reactivity and polarity. The propyl group attached to the nitrogen atom contributes to the compound's hydrophobic characteristics, which can affect its solubility in various solvents. This compound is of interest in medicinal chemistry and drug development due to its potential biological activity and ability to interact with various biological targets. Its fluorinated nature may enhance metabolic stability and influence pharmacokinetic properties. As with many piperidine derivatives, it may exhibit a range of effects depending on its specific molecular interactions. Safety and handling considerations are essential, as fluorinated compounds can pose unique hazards. Overall, 4,4-Difluoro-1-propylpiperidine represents a valuable structure for further research in chemical and pharmaceutical applications.
Formula:C8H15F2N
InChI:InChI=1S/C8H15F2N/c1-2-5-11-6-3-8(9,10)4-7-11/h2-7H2,1H3
InChI key:InChIKey=ZWKQQVDONOMRAX-UHFFFAOYSA-N
SMILES:C(CC)N1CCC(F)(F)CC1
Synonyms:
  • 4,4-Difluoro-1-propylpiperidine
  • Piperidine, 4,4-difluoro-1-propyl-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.