CAS 1159988-49-4

3,5-Bis(3-methoxyphenyl)-1H-pyrazole

Description:

3,5-Bis(3-methoxyphenyl)-1H-pyrazole is an organic compound characterized by its pyrazole core, which is a five-membered ring containing two nitrogen atoms. This compound features two 3-methoxyphenyl groups attached to the 3 and 5 positions of the pyrazole ring, contributing to its structural complexity and potential for various interactions. The presence of methoxy groups enhances its solubility in organic solvents and may influence its reactivity and biological activity. Typically, compounds like this can exhibit interesting pharmacological properties, making them of interest in medicinal chemistry. The molecular structure suggests potential applications in areas such as drug development, where modifications to the phenyl groups can lead to variations in activity. Additionally, the compound's properties, such as melting point, boiling point, and spectral characteristics, would be essential for its identification and characterization in laboratory settings. Overall, 3,5-Bis(3-methoxyphenyl)-1H-pyrazole represents a class of compounds that may have significant implications in chemical research and application.

Formula: C₁₇H₁₆N₂O₂

InChI: InChI=1S/C17H16N2O2/c1-20-14-7-3-5-12(9-14)16-11-17(19-18-16)13-6-4-8-15(10-13)21-2/h3-11H,1-2H3,(H,18,19)

InChI key: InChIKey=MCIHZKAEEMHEPO-UHFFFAOYSA-N

SMILES: O(C)C=1C=C(C=2C=C(NN2)C3=CC(OC)=CC=C3)C=CC1

Synonyms:

• 3,5-Bis(3-methoxyphenyl)-1H-pyrazole
• 1H-Pyrazole, 3,5-bis(3-methoxyphenyl)-

3,5-Bis(3-methoxyphenyl)-1H-pyrazole

CAS: 1159988-49-4

Versatile small molecule scaffold

Formula: C₁₇H₁₆N₂O₂

Purity: Min. 95%

Molecular weight: 280.32 g/mol

Ref: 3D-JWB98849