
CAS 1159988-70-1
:1-Methyl-5-[[(1H-pyrazol-3-ylmethyl)amino]carbonyl]-1H-pyrazole-4-carboxylic acid
Description:
1-Methyl-5-[[(1H-pyrazol-3-ylmethyl)amino]carbonyl]-1H-pyrazole-4-carboxylic acid is a chemical compound characterized by its complex structure, which includes multiple functional groups. It features a pyrazole core, which is a five-membered ring containing two nitrogen atoms, contributing to its potential biological activity. The presence of a carboxylic acid group indicates that it can participate in acid-base reactions and may exhibit polar characteristics, enhancing its solubility in polar solvents. The compound also contains an amide linkage, suggesting potential for hydrogen bonding, which can influence its interactions with biological targets. Its methyl group may affect the steric hindrance and overall reactivity. This compound is of interest in medicinal chemistry, particularly for its potential applications in drug development, given the presence of the pyrazole moiety, which is often associated with various pharmacological activities. Overall, its unique structural features may contribute to its biological properties, making it a subject of research in the fields of organic and medicinal chemistry.
Formula:C10H11N5O3
InChI:InChI=1S/C10H11N5O3/c1-15-8(7(5-13-15)10(17)18)9(16)11-4-6-2-3-12-14-6/h2-3,5H,4H2,1H3,(H,11,16)(H,12,14)(H,17,18)
InChI key:InChIKey=NEBILLUMNBFUSW-UHFFFAOYSA-N
SMILES:C(NCC=1C=CNN1)(=O)C2=C(C(O)=O)C=NN2C
Synonyms:- 1H-Pyrazole-4-carboxylic acid, 1-methyl-5-[[(1H-pyrazol-3-ylmethyl)amino]carbonyl]-
- 1-Methyl-5-[[(1H-pyrazol-3-ylmethyl)amino]carbonyl]-1H-pyrazole-4-carboxylic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.