CAS 1159988-71-2
:4-Methyl-3,5-bis(3-methylphenyl)-1H-pyrazole
Description:
4-Methyl-3,5-bis(3-methylphenyl)-1H-pyrazole is an organic compound characterized by its pyrazole core, which is a five-membered ring containing two nitrogen atoms. This compound features two 3-methylphenyl substituents at the 3 and 5 positions of the pyrazole ring, along with a methyl group at the 4 position. The presence of these aromatic groups contributes to its potential for various interactions, including π-π stacking and hydrophobic interactions, which can influence its solubility and reactivity. The compound may exhibit interesting biological activities due to its structural features, making it a candidate for research in medicinal chemistry. Additionally, its molecular structure suggests potential applications in materials science, particularly in the development of organic semiconductors or dyes. As with many pyrazole derivatives, the compound's properties, such as melting point, boiling point, and solubility, would depend on the specific arrangement of its substituents and the overall molecular interactions. Further studies would be necessary to fully elucidate its characteristics and potential applications.
Formula:C18H18N2
InChI:InChI=1S/C18H18N2/c1-12-6-4-8-15(10-12)17-14(3)18(20-19-17)16-9-5-7-13(2)11-16/h4-11H,1-3H3,(H,19,20)
InChI key:InChIKey=BUVIMERBOBZZSX-UHFFFAOYSA-N
SMILES:CC=1C(=NNC1C2=CC(C)=CC=C2)C3=CC(C)=CC=C3
Synonyms:- 1H-Pyrazole, 4-methyl-3,5-bis(3-methylphenyl)-
- 4-Methyl-3,5-bis(3-methylphenyl)-1H-pyrazole
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.