CAS 1159988-73-4
:4-Chloro-3,5-bis(3,4-dimethoxyphenyl)-1H-pyrazole
Description:
4-Chloro-3,5-bis(3,4-dimethoxyphenyl)-1H-pyrazole is a synthetic organic compound characterized by its pyrazole core, which is a five-membered ring containing two nitrogen atoms. The presence of the chloro substituent at the 4-position and two 3,4-dimethoxyphenyl groups at the 3 and 5 positions contributes to its unique chemical properties. This compound is likely to exhibit significant lipophilicity due to the methoxy groups, which can enhance its solubility in organic solvents. The presence of the chloro group may also influence its reactivity and potential biological activity. Pyrazole derivatives are known for their diverse pharmacological properties, including anti-inflammatory and analgesic effects, making this compound of interest in medicinal chemistry. Additionally, the specific arrangement of substituents can affect its electronic properties, potentially leading to interesting interactions in biological systems. Overall, 4-Chloro-3,5-bis(3,4-dimethoxyphenyl)-1H-pyrazole represents a complex structure with potential applications in drug development and research.
Formula:C19H19ClN2O4
InChI:InChI=1S/C19H19ClN2O4/c1-23-13-7-5-11(9-15(13)25-3)18-17(20)19(22-21-18)12-6-8-14(24-2)16(10-12)26-4/h5-10H,1-4H3,(H,21,22)
InChI key:InChIKey=ORNMEMRMEZYWFE-UHFFFAOYSA-N
SMILES:ClC=1C(=NNC1C2=CC(OC)=C(OC)C=C2)C3=CC(OC)=C(OC)C=C3
Synonyms:- 4-Chloro-3,5-bis(3,4-dimethoxyphenyl)-1H-pyrazole
- 1H-Pyrazole, 4-chloro-3,5-bis(3,4-dimethoxyphenyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.