CAS 1159989-41-9
:4-Ethyl-3,5-bis(3-methoxyphenyl)-1H-pyrazole
Description:
4-Ethyl-3,5-bis(3-methoxyphenyl)-1H-pyrazole is an organic compound characterized by its pyrazole core, which is a five-membered ring containing two nitrogen atoms. This compound features ethyl and methoxyphenyl substituents, contributing to its unique chemical properties. The presence of the ethyl group enhances its hydrophobic character, while the methoxyphenyl groups can influence its reactivity and solubility in organic solvents. The methoxy groups also provide potential sites for further chemical modification. This compound may exhibit interesting biological activities, making it a subject of interest in medicinal chemistry. Its structure suggests potential interactions with biological targets, which could be explored in drug development. Additionally, the compound's stability and reactivity can be influenced by the electronic effects of the substituents, making it a valuable candidate for various synthetic applications. Overall, 4-Ethyl-3,5-bis(3-methoxyphenyl)-1H-pyrazole represents a versatile structure with potential implications in both research and industrial contexts.
Formula:C19H20N2O2
InChI:InChI=1S/C19H20N2O2/c1-4-17-18(13-7-5-9-15(11-13)22-2)20-21-19(17)14-8-6-10-16(12-14)23-3/h5-12H,4H2,1-3H3,(H,20,21)
InChI key:InChIKey=QQRVVHXTHPOMMJ-UHFFFAOYSA-N
SMILES:C(C)C=1C(=NNC1C2=CC(OC)=CC=C2)C3=CC(OC)=CC=C3
Synonyms:- 4-Ethyl-3,5-bis(3-methoxyphenyl)-1H-pyrazole
- 1H-Pyrazole, 4-ethyl-3,5-bis(3-methoxyphenyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.