
CAS 116-50-7
:1,2-Ethanediol, 1,2-dibenzenesulfonate
Description:
1,2-Ethanediol, 1,2-dibenzenesulfonate, commonly known as ethylene glycol dibenzenesulfonate, is an organic compound characterized by its structure, which features two benzene rings attached to a sulfonate group and an ethylene glycol backbone. This compound is typically a colorless to pale yellow liquid with a sweet taste and is soluble in water due to the presence of the hydroxyl groups from the ethylene glycol moiety. It exhibits hygroscopic properties, meaning it can absorb moisture from the air. The sulfonate groups enhance its solubility in polar solvents and contribute to its potential applications as a surfactant or in the formulation of various chemical products. Additionally, it may be used in the synthesis of other chemical compounds or as an intermediate in organic reactions. However, safety precautions should be taken when handling this substance, as it may pose health risks upon exposure. Always refer to safety data sheets for detailed information on handling and potential hazards.
Formula:C14H14O6S2
InChI:InChI=1S/C14H14O6S2/c15-21(16,13-7-3-1-4-8-13)19-11-12-20-22(17,18)14-9-5-2-6-10-14/h1-10H,11-12H2
InChI key:InChIKey=LLHMWTOYUSTYGU-UHFFFAOYSA-N
SMILES:S(OCCOS(=O)(=O)C1=CC=CC=C1)(=O)(=O)C2=CC=CC=C2
Synonyms:- 1,2-Ethanediol, 1,2-dibenzenesulfonate
- 1,2-Ethanediol, dibenzenesulfonate
- 2-(Benzenesulfonyloxy)ethyl benzenesulfonate
- Ethylene glycol, dibenzenesulfonate
- NSC 3220
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.

