
CAS 116-78-9
:1,5-Bis(2,4-dinitrophenoxy)-4,8-dinitro-9,10-anthracenedione
Description:
1,5-Bis(2,4-dinitrophenoxy)-4,8-dinitro-9,10-anthracenedione, commonly referred to by its CAS number 116-78-9, is a synthetic organic compound characterized by its complex structure, which includes multiple nitro groups and phenoxy substituents. This compound is known for its vibrant color, typically exhibiting a deep red or orange hue due to the presence of the anthraquinone moiety. It is primarily utilized in research and industrial applications, particularly in the field of dyes and pigments. The presence of dinitrophenoxy groups enhances its reactivity and solubility in various organic solvents. Additionally, the compound is recognized for its potential applications in the synthesis of other chemical entities and as a reagent in analytical chemistry. However, due to the presence of multiple nitro groups, it may also exhibit explosive properties under certain conditions, necessitating careful handling and storage. Overall, this compound serves as an important example of functionalized organic materials in both academic and industrial chemistry.
Formula:C26H10N6O16
InChI:InChI=1S/C26H10N6O16/c33-25-22-14(30(41)42)4-8-20(48-18-6-2-12(28(37)38)10-16(18)32(45)46)24(22)26(34)21-13(29(39)40)3-7-19(23(21)25)47-17-5-1-11(27(35)36)9-15(17)31(43)44/h1-10H
InChI key:InChIKey=JPBCMHKLKIEZEF-UHFFFAOYSA-N
SMILES:O(C1=C2C(C(=O)C=3C(C2=O)=C(N(=O)=O)C=CC3OC4=C(N(=O)=O)C=C(N(=O)=O)C=C4)=C(N(=O)=O)C=C1)C5=C(N(=O)=O)C=C(N(=O)=O)C=C5
Synonyms:- 9,10-Anthracenedione, 1,5-bis(2,4-dinitrophenoxy)-4,8-dinitro-
- Anthraquinone, 1,5-bis(2,4-dinitrophenoxy)-4,8-dinitro-
- 1,5-Bis(2,4-dinitrophenoxy)-4,8-dinitro-9,10-anthracenedione
- 1,5-Bis(2,4-dinitrophenoxy)-4,8-dinitroanthraquinone
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
9,10-Anthracenedione, 1,5-bis(2,4-dinitrophenoxy)-4,8-dinitro-
CAS:Formula:C26H10N6O16Molecular weight:662.3882Ref: 4Z-A-191013
Discontinued product

