CymitQuimica logo

CAS 116-83-6

:

1-Amino-4-methoxy-9,10-anthracenedione

Description:
1-Amino-4-methoxy-9,10-anthracenedione, also known as "amino-anthraquinone," is an organic compound characterized by its anthraquinone structure, which consists of three fused benzene rings with two carbonyl groups and an amino group. This compound typically appears as a dark-colored solid and is known for its potential applications in dyeing and as a pigment due to its vibrant color properties. The presence of the methoxy group enhances its solubility in organic solvents, making it useful in various chemical processes. Additionally, the amino group can participate in further chemical reactions, allowing for modifications that can tailor its properties for specific applications. 1-Amino-4-methoxy-9,10-anthracenedione is also studied for its potential biological activities, including antitumor and antimicrobial properties. However, handling this compound requires caution due to its potential toxicity and environmental impact. Overall, its unique structure and functional groups contribute to its versatility in both industrial and research settings.
Formula:C15H11NO3
InChI:InChI=1S/C15H11NO3/c1-19-11-7-6-10(16)12-13(11)15(18)9-5-3-2-4-8(9)14(12)17/h2-7H,16H2,1H3
InChI key:InChIKey=KXOGXZAXERYOTC-UHFFFAOYSA-N
SMILES:O=C1C=2C(C(=O)C=3C1=CC=CC3)=C(N)C=CC2OC
Synonyms:
  • 9,10-Anthracenedione, 1-amino-4-methoxy-
  • 1-Amino-4-methoxyanthraquinone
  • 4-Methoxy-1-anthraquinonylamine
  • 1-Amino-4-methoxy-9,10-anthracenedione
  • Anthraquinone, 1-amino-4-methoxy-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.