CAS 116-84-7
:1-Amino-5-chloro-4-hydroxy-9,10-anthracenedione
Description:
1-Amino-5-chloro-4-hydroxy-9,10-anthracenedione, also known as chloranil, is an organic compound characterized by its anthraquinone structure, which features a fused ring system. This compound is notable for its bright yellow color and is primarily used as a dye and pigment. It exhibits strong electron-accepting properties due to the presence of the quinone functional groups, making it useful in various applications, including as a reagent in organic synthesis and as a component in electrochemical devices. The presence of the amino and hydroxy groups contributes to its reactivity, allowing it to participate in various chemical reactions, such as nucleophilic substitutions. Chloranil is also known for its antimicrobial properties and has been studied for potential applications in medicine. However, it is important to handle this compound with care, as it can be toxic and may pose environmental hazards. Overall, 1-amino-5-chloro-4-hydroxy-9,10-anthracenedione is a versatile compound with significant industrial and research relevance.
Formula:C14H8ClNO3
InChI:InChI=1S/C14H8ClNO3/c15-7-3-1-2-6-10(7)14(19)12-9(17)5-4-8(16)11(12)13(6)18/h1-5,17H,16H2
InChI key:InChIKey=QAZNDGDSNIGKLU-UHFFFAOYSA-N
SMILES:O=C1C=2C(C(=O)C=3C1=C(Cl)C=CC3)=C(N)C=CC2O
Synonyms:- 1-Amino-5-chloro-4-hydroxy-9,10-anthracenedione
- 1-Amino-5-chloro-4-hydroxyanthraquinone
- Anthraquinone, 1-amino-5-chloro-4-hydroxy-
- 9,10-Anthracenedione, 1-amino-5-chloro-4-hydroxy-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
