
CAS 1160107-44-7
:(1E,6E)-1,7-Bis(4-hydroxy-3-methoxyphenyl)-4-[(4-hydroxy-3-methoxyphenyl)methyl]-1,6-heptadiene-3,5-dione
Description:
(1E,6E)-1,7-Bis(4-hydroxy-3-methoxyphenyl)-4-[(4-hydroxy-3-methoxyphenyl)methyl]-1,6-heptadiene-3,5-dione, with CAS number 1160107-44-7, is a synthetic organic compound characterized by its complex polyphenolic structure. This compound features multiple hydroxyl and methoxy groups, which contribute to its potential antioxidant properties and biological activity. The heptadiene backbone indicates the presence of conjugated double bonds, which can influence its reactivity and stability. The presence of multiple aromatic rings suggests that it may exhibit significant UV-absorbing properties, making it of interest in photoprotective applications. Additionally, the compound's structure may allow for interactions with various biological targets, potentially leading to therapeutic effects. Its solubility, stability, and reactivity can vary depending on the solvent and environmental conditions, which are important considerations for its application in research and industry. Overall, this compound represents a class of polyphenolic compounds that may have diverse applications in pharmaceuticals, cosmetics, and materials science.
Formula:C29H28O8
InChI:InChI=1S/C29H28O8/c1-35-27-15-18(6-11-24(27)32)4-9-22(30)21(14-20-8-13-26(34)29(17-20)37-3)23(31)10-5-19-7-12-25(33)28(16-19)36-2/h4-13,15-17,21,32-34H,14H2,1-3H3/b9-4+,10-5+
InChI key:InChIKey=YYKIPSPMJXEHDD-LUZURFALSA-N
SMILES:C(C(C(/C=C/C1=CC(OC)=C(O)C=C1)=O)C(/C=C/C2=CC(OC)=C(O)C=C2)=O)C3=CC(OC)=C(O)C=C3
Synonyms:- 1,6-Heptadiene-3,5-dione, 1,7-bis(4-hydroxy-3-methoxyphenyl)-4-[(4-hydroxy-3-methoxyphenyl)methyl]-, (1E,6E)-
- C 086
- (1E,6E)-1,7-Bis(4-hydroxy-3-methoxyphenyl)-4-[(4-hydroxy-3-methoxyphenyl)methyl]-1,6-heptadiene-3,5-dione
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
C086
CAS:C086 is a novel and potent Hsp90 inhibitor that suppresses cell cycle progression, induces apoptosis, and exhibits anti-metastatic properties by modulating various mechanisms in different cell types.Formula:C29H28O8Color and Shape:SolidMolecular weight:504.53
