CAS 116015-72-6
:Sucrose 4,6-Methyl Orthoester
Description:
Sucrose 4,6-Methyl Orthoester, identified by its CAS number 116015-72-6, is a derivative of sucrose, a common disaccharide composed of glucose and fructose. This compound features methyl ester groups at the 4 and 6 positions of the sucrose molecule, which can influence its solubility, reactivity, and biological properties. Typically, such modifications can enhance the compound's stability and alter its interaction with biological systems, making it of interest in various fields, including food science and pharmaceuticals. The presence of methyl groups may also affect the compound's sweetness and flavor profile, potentially making it useful as a sweetening agent or in the formulation of food products. Additionally, the structural modifications can impact the compound's physical properties, such as melting point and viscosity. As with many sucrose derivatives, Sucrose 4,6-Methyl Orthoester may exhibit unique characteristics that could be exploited in research and industrial applications, particularly in the development of novel materials or therapeutic agents.
Formula:C15H26O12
InChI:InChI=1/C15H26O12/c1-14(22-2)23-4-7-11(26-14)9(19)10(20)13(24-7)27-15(5-17)12(21)8(18)6(3-16)25-15/h6-13,16-21H,3-5H2,1-2H3/t6-,7?,8+,9?,10?,11?,12-,13?,14?,15+/m1/s1
Synonyms:- -D-Fructofuranosyl 4,6-O-(1-methoxyethylidene)-a-D-glucopyranoside
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
α-D-Glucopyranoside, β-D-fructofuranosyl 4,6-O-(1-methoxyethylidene)-
CAS:Formula:C15H26O12Color and Shape:SolidMolecular weight:398.3597Sucrose 4,6-methyl orthoester
CAS:Sucrose 4,6-methyl orthoester is a sugar derivative that can be synthesized from sucrose. Sucrose 4,6-methyl orthoester is a white solid that is soluble in water, methanol, and acetone. It has been shown to have the same properties as sucrose but with higher stability in acidic conditions and at high temperatures. This compound has been custom synthesized by our laboratory to produce a high purity product.Formula:C15H26O12Purity:Min. 95%Molecular weight:398.36 g/mol


