CAS 116016-56-9
:5-(4-METHOXYPHENYL)-2-THIOPHENECARBOXYLIC ACID
Description:
5-(4-Methoxyphenyl)-2-thiophenecarboxylic acid is an organic compound characterized by its unique structure, which includes a thiophene ring and a methoxy-substituted phenyl group. This compound features a carboxylic acid functional group, contributing to its acidic properties. The presence of the methoxy group enhances its solubility in organic solvents and may influence its reactivity and interaction with biological systems. The thiophene ring adds to the compound's aromatic character, potentially affecting its electronic properties and stability. This substance may exhibit interesting biological activities, making it of interest in pharmaceutical research. Its molecular structure allows for various potential applications in organic synthesis and materials science. Additionally, the compound's CAS number, 116016-56-9, serves as a unique identifier for regulatory and safety information. Overall, 5-(4-methoxyphenyl)-2-thiophenecarboxylic acid is a versatile compound with significant implications in both chemical research and practical applications.
Formula:C12H10O3S
InChI:InChI=1/C12H10O3S/c1-15-9-4-2-8(3-5-9)10-6-7-11(16-10)12(13)14/h2-7H,1H3,(H,13,14)
SMILES:COc1ccc(cc1)c1ccc(C(=O)O)s1
Synonyms:- Akos Bar-0577
- Akos B029965
- 5-(4-Methoxyphenyl)Thiophene-2-Carboxylic Acid
- Rarechem Al Be 1105
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
5-(4-Methoxyphenyl)thiophene-2-carboxylic acid
CAS:Formula:C12H10O3SColor and Shape:SolidMolecular weight:234.2710
