CAS 116016-59-2

2′-Chloro[2,3′-bithiophene]-5-carboxylic acid

Description:

2′-Chloro[2,3′-bithiophene]-5-carboxylic acid is an organic compound characterized by its bithiophene structure, which consists of two thiophene rings connected by a carbon-carbon bond. The presence of a carboxylic acid functional group (-COOH) at the 5-position contributes to its acidity and potential for forming hydrogen bonds, enhancing its solubility in polar solvents. The chlorine substituent at the 2′ position introduces electronegativity, which can influence the compound's electronic properties and reactivity. This compound is of interest in organic electronics and materials science due to its conjugated system, which can facilitate charge transport. Additionally, its structural features may allow for various synthetic modifications, making it a versatile building block in the development of organic semiconductors and other functional materials. Overall, 2′-Chloro[2,3′-bithiophene]-5-carboxylic acid exhibits unique chemical properties that make it valuable for research and application in advanced materials.

Formula: C₉H₅ClO₂S₂

InChI: InChI=1S/C9H5ClO2S2/c10-8-5(3-4-13-8)6-1-2-7(14-6)9(11)12/h1-4H,(H,11,12)

InChI key: InChIKey=WAUWILDVRDJQOG-UHFFFAOYSA-N

SMILES: ClC1=C(C=2SC(C(O)=O)=CC2)C=CS1

Synonyms:

• 2′-Chloro[2,3′-bithiophene]-5-carboxylic acid
• [2,3′-Bithiophene]-5-carboxylic acid, 2′-chloro-