CAS 1160182-45-5

2-Bromo-3-(1,3-dioxolan-2-yl)phenol

Description:

2-Bromo-3-(1,3-dioxolan-2-yl)phenol is an organic compound characterized by its phenolic structure, which includes a bromine substituent and a dioxolane ring. The presence of the bromine atom introduces notable reactivity, making it a potential candidate for various chemical transformations, including nucleophilic substitutions. The dioxolane moiety contributes to the compound's stability and solubility in polar solvents, enhancing its utility in synthetic applications. This compound may exhibit biological activity, as many phenolic derivatives are known for their antioxidant properties and potential therapeutic effects. Its molecular structure suggests that it could participate in hydrogen bonding due to the hydroxyl group, influencing its physical properties such as melting point and solubility. Additionally, the compound's unique functional groups may allow for further derivatization, making it valuable in medicinal chemistry and materials science. As with any chemical substance, safety precautions should be observed when handling it, given the potential hazards associated with brominated compounds.

Formula: C₉H₉BrO₃

InChI: InChI=1S/C9H9BrO3/c10-8-6(2-1-3-7(8)11)9-12-4-5-13-9/h1-3,9,11H,4-5H2

InChI key: InChIKey=TTYJRRVBSDEWIN-UHFFFAOYSA-N

SMILES: BrC1=C(C=CC=C1O)C2OCCO2

Synonyms:

• Phenol, 2-bromo-3-(1,3-dioxolan-2-yl)-
• 2-Bromo-3-(1,3-dioxolan-2-yl)phenol