CymitQuimica logo

CAS 1160245-40-8

:

N-Phenyl-N-[(2,3,4,5-tetrahydro-1,4-benzoxazepin-7-yl)methyl]cyclopropanecarboxamide

Description:
N-Phenyl-N-[(2,3,4,5-tetrahydro-1,4-benzoxazepin-7-yl)methyl]cyclopropanecarboxamide is a chemical compound characterized by its complex structure, which includes a cyclopropanecarboxamide moiety and a tetrahydro-benzoxazepine ring. This compound features a phenyl group attached to a nitrogen atom, indicating potential aromatic properties and interactions. The presence of the cyclopropane ring suggests unique strain and reactivity, which can influence its chemical behavior and biological activity. The benzoxazepine structure is known for its potential pharmacological properties, often associated with neuroactive compounds. This compound may exhibit various interactions due to its multiple functional groups, making it of interest in medicinal chemistry and drug development. Its specific properties, such as solubility, stability, and reactivity, would depend on the surrounding conditions and the presence of other chemical entities. Overall, this compound represents a class of organic molecules that could have significant implications in therapeutic applications, particularly in the fields of neuroscience and pharmacology.
Formula:C20H22N2O2
InChI:InChI=1S/C20H22N2O2/c23-20(16-7-8-16)22(18-4-2-1-3-5-18)14-15-6-9-19-17(12-15)13-21-10-11-24-19/h1-6,9,12,16,21H,7-8,10-11,13-14H2
InChI key:InChIKey=AMLPMNOKTCDBPX-UHFFFAOYSA-N
SMILES:N(CC=1C=C2C(=CC1)OCCNC2)(C(=O)C3CC3)C4=CC=CC=C4
Synonyms:
  • Cyclopropanecarboxamide, N-phenyl-N-[(2,3,4,5-tetrahydro-1,4-benzoxazepin-7-yl)methyl]-
  • N-Phenyl-N-[(2,3,4,5-tetrahydro-1,4-benzoxazepin-7-yl)methyl]cyclopropanecarboxamide
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.