CymitQuimica logo

CAS 1160245-44-2

:

4-Methyl-N-phenyl-N-[(4,5,6,7-tetrahydro-1-methyl-1H-pyrazolo[4,3-c]pyridin-3-yl)methyl]benzamide

Description:
4-Methyl-N-phenyl-N-[(4,5,6,7-tetrahydro-1-methyl-1H-pyrazolo[4,3-c]pyridin-3-yl)methyl]benzamide, identified by its CAS number 1160245-44-2, is a chemical compound characterized by its complex structure, which includes a benzamide moiety and a tetrahydro-pyrazolo-pyridine derivative. This compound typically exhibits properties associated with both aromatic and aliphatic systems, contributing to its potential biological activity. The presence of the methyl and phenyl groups suggests lipophilicity, which may influence its solubility and interaction with biological membranes. Additionally, the tetrahydro-pyrazolo-pyridine structure may impart specific pharmacological properties, making it of interest in medicinal chemistry. The compound's synthesis and characterization would involve standard organic chemistry techniques, including NMR, mass spectrometry, and possibly X-ray crystallography for structural elucidation. Its potential applications could span various fields, including pharmaceuticals, where it may serve as a lead compound for drug development targeting specific biological pathways. However, detailed studies on its biological activity, toxicity, and pharmacokinetics would be necessary to fully understand its utility.
Formula:C22H24N4O
InChI:InChI=1S/C22H24N4O/c1-16-8-10-17(11-9-16)22(27)26(18-6-4-3-5-7-18)15-20-19-14-23-13-12-21(19)25(2)24-20/h3-11,23H,12-15H2,1-2H3
InChI key:InChIKey=OHRDRLLNBUIALU-UHFFFAOYSA-N
SMILES:C(N(C(=O)C1=CC=C(C)C=C1)C2=CC=CC=C2)C=3C4=C(N(C)N3)CCNC4
Synonyms:
  • 4-Methyl-N-phenyl-N-[(4,5,6,7-tetrahydro-1-methyl-1H-pyrazolo[4,3-c]pyridin-3-yl)methyl]benzamide
  • Benzamide, 4-methyl-N-phenyl-N-[(4,5,6,7-tetrahydro-1-methyl-1H-pyrazolo[4,3-c]pyridin-3-yl)methyl]-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.