CAS 1160245-55-5

Methyl α-methyl-4-piperidineacetate

Description:

Methyl α-methyl-4-piperidineacetate is a chemical compound characterized by its piperidine ring structure, which is a six-membered nitrogen-containing heterocycle. This compound features an acetate functional group, contributing to its reactivity and solubility properties. It is typically a colorless to pale yellow liquid or solid, depending on its purity and specific formulation. The presence of the methyl group at the alpha position enhances its steric properties, potentially influencing its biological activity and interactions with other molecules. Methyl α-methyl-4-piperidineacetate may exhibit moderate polarity, making it soluble in organic solvents while having limited solubility in water. Its applications can span various fields, including pharmaceuticals and organic synthesis, where it may serve as an intermediate or a building block for more complex molecules. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper precautions are taken due to potential toxicity or reactivity.

Formula: C₉H₁₇NO₂

InChI: InChI=1S/C9H17NO2/c1-7(9(11)12-2)8-3-5-10-6-4-8/h7-8,10H,3-6H2,1-2H3

InChI key: InChIKey=LCIWBZVLPYHUCC-UHFFFAOYSA-N

SMILES: C(C(OC)=O)(C)C1CCNCC1

Synonyms:

• 4-Piperidineacetic acid, α-methyl-, methyl ester
• Methyl α-methyl-4-piperidineacetate