CymitQuimica logo

CAS 1160245-66-8

:

9-(Phenylmethyl)-6-oxa-9-azaspiro[3.6]decan-8-one

Description:
9-(Phenylmethyl)-6-oxa-9-azaspiro[3.6]decan-8-one, identified by its CAS number 1160245-66-8, is a chemical compound characterized by its unique spirocyclic structure, which incorporates both nitrogen and oxygen heteroatoms. This compound features a spiro linkage that connects a saturated nitrogen-containing ring to a carbonyl group, contributing to its potential biological activity. The presence of the phenylmethyl group enhances its lipophilicity, which may influence its interaction with biological membranes and receptors. The oxo and aza functionalities suggest potential reactivity and the ability to participate in various chemical transformations. Such compounds are often of interest in medicinal chemistry due to their structural complexity and potential pharmacological properties. The specific stereochemistry and substituents can significantly affect the compound's behavior in biological systems, making it a candidate for further research in drug development and synthesis. Overall, this compound exemplifies the intricate relationship between molecular structure and biological activity in organic chemistry.
Formula:C15H19NO2
InChI:InChI=1S/C15H19NO2/c17-14-10-18-12-15(7-4-8-15)11-16(14)9-13-5-2-1-3-6-13/h1-3,5-6H,4,7-12H2
InChI key:InChIKey=FABJPZMJWOYBRW-UHFFFAOYSA-N
SMILES:C(N1CC2(CCC2)COCC1=O)C3=CC=CC=C3
Synonyms:
  • 6-Oxa-9-azaspiro[3.6]decan-8-one, 9-(phenylmethyl)-
  • 9-(Phenylmethyl)-6-oxa-9-azaspiro[3.6]decan-8-one
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.