CAS 1160245-90-8

5-(3-Methoxyphenyl)-7-(trifluoromethyl)[1,2,4]triazolo[1,5-a]pyrimidine-2-acetic acid

Description:

5-(3-Methoxyphenyl)-7-(trifluoromethyl)[1,2,4]triazolo[1,5-a]pyrimidine-2-acetic acid is a chemical compound characterized by its complex heterocyclic structure, which includes a triazole and pyrimidine moiety. This compound features a methoxyphenyl group and a trifluoromethyl substituent, contributing to its unique chemical properties and potential biological activity. The presence of the acetic acid functional group suggests that it may exhibit acidic behavior, which can influence its solubility and reactivity in various environments. The trifluoromethyl group is known to enhance lipophilicity and metabolic stability, making this compound of interest in medicinal chemistry. Its structural features may also suggest potential applications in pharmaceuticals, particularly in the development of agents targeting specific biological pathways. Overall, the combination of these functional groups and structural elements makes this compound a subject of interest for further research in both synthetic and medicinal chemistry contexts.

Formula: C₁₅H₁₁F₃N₄O₃

InChI: InChI=1S/C15H11F3N4O3/c1-25-9-4-2-3-8(5-9)10-6-11(15(16,17)18)22-14(19-10)20-12(21-22)7-13(23)24/h2-6H,7H2,1H3,(H,23,24)

InChI key: InChIKey=XUEZJTVYRVAYRO-UHFFFAOYSA-N

SMILES: C(F)(F)(F)C=1N2C(N=C(C1)C3=CC(OC)=CC=C3)=NC(CC(O)=O)=N2

Synonyms:

• [1,2,4]Triazolo[1,5-a]pyrimidine-2-acetic acid, 5-(3-methoxyphenyl)-7-(trifluoromethyl)-
• 5-(3-Methoxyphenyl)-7-(trifluoromethyl)[1,2,4]triazolo[1,5-a]pyrimidine-2-acetic acid