CAS 1160246-05-8

Ethyl 6,7-dihydro-1-(4-methoxyphenyl)-3-methyl-6-oxo-1H-pyrazolo[3,4-b]pyridine-4-carboxylate

Description:

Ethyl 6,7-dihydro-1-(4-methoxyphenyl)-3-methyl-6-oxo-1H-pyrazolo[3,4-b]pyridine-4-carboxylate is a complex organic compound characterized by its pyrazolo-pyridine structure, which features a fused bicyclic system. This compound contains a carboxylate ester functional group, contributing to its potential reactivity and solubility properties. The presence of a methoxyphenyl substituent enhances its lipophilicity and may influence its biological activity. The compound's molecular framework suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to its structural motifs that may interact with biological targets. Additionally, the presence of the keto group and the ethyl ester may affect its stability and reactivity under various conditions. As with many organic compounds, its physical properties, such as melting point, boiling point, and solubility, would depend on the specific conditions and purity of the sample. Overall, this compound represents a class of heterocyclic compounds that are of interest for their potential therapeutic applications.

Formula: C₁₇H₁₇N₃O₄

InChI: InChI=1S/C17H17N3O4/c1-4-24-17(22)13-9-14(21)18-16-15(13)10(2)19-20(16)11-5-7-12(23-3)8-6-11/h5-9H,4H2,1-3H3,(H,18,21)

InChI key: InChIKey=PKGLIPJCPUFGJA-UHFFFAOYSA-N

SMILES: C(OCC)(=O)C=1C2=C(N(N=C2C)C3=CC=C(OC)C=C3)NC(=O)C1

Synonyms:

• Ethyl 6,7-dihydro-1-(4-methoxyphenyl)-3-methyl-6-oxo-1H-pyrazolo[3,4-b]pyridine-4-carboxylate
• 1H-Pyrazolo[3,4-b]pyridine-4-carboxylic acid, 6,7-dihydro-1-(4-methoxyphenyl)-3-methyl-6-oxo-, ethyl ester