CAS 1160246-06-9
:7-(Difluoromethyl)-5-(3-methoxyphenyl)[1,2,4]triazolo[1,5-a]pyrimidine-2-propanoic acid
Description:
7-(Difluoromethyl)-5-(3-methoxyphenyl)[1,2,4]triazolo[1,5-a]pyrimidine-2-propanoic acid is a chemical compound characterized by its complex structure, which includes a triazole ring fused to a pyrimidine moiety. This compound features a difluoromethyl group and a methoxyphenyl substituent, contributing to its unique chemical properties. It is likely to exhibit biological activity, potentially serving as a pharmaceutical agent or a research chemical, although specific biological targets or mechanisms may vary. The presence of the propanoic acid functional group suggests potential acidity and reactivity, which could influence its solubility and interaction with biological systems. The compound's molecular structure indicates it may participate in hydrogen bonding and other intermolecular interactions, affecting its pharmacokinetics and pharmacodynamics. As with many synthetic organic compounds, its stability, reactivity, and potential applications would depend on the specific conditions under which it is used, including pH, temperature, and the presence of other chemical species. Further studies would be necessary to fully elucidate its properties and potential uses.
Formula:C16H14F2N4O3
InChI:InChI=1S/C16H14F2N4O3/c1-25-10-4-2-3-9(7-10)11-8-12(15(17)18)22-16(19-11)20-13(21-22)5-6-14(23)24/h2-4,7-8,15H,5-6H2,1H3,(H,23,24)
InChI key:InChIKey=MWOGKKFPNAPMNM-UHFFFAOYSA-N
SMILES:C(F)(F)C=1N2C(N=C(C1)C3=CC(OC)=CC=C3)=NC(CCC(O)=O)=N2
Synonyms:- [1,2,4]Triazolo[1,5-a]pyrimidine-2-propanoic acid, 7-(difluoromethyl)-5-(3-methoxyphenyl)-
- 7-(Difluoromethyl)-5-(3-methoxyphenyl)[1,2,4]triazolo[1,5-a]pyrimidine-2-propanoic acid
- 3-[7-Difluoromethyl)-5-(3-methoxyphenyl)-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl]propanoic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.