CAS 1160246-17-2

Ethyl 3-cyclopropyl-6,7-dihydro-6-oxo-1-(phenylmethyl)-1H-pyrazolo[3,4-b]pyridine-4-carboxylate

Description:

Ethyl 3-cyclopropyl-6,7-dihydro-6-oxo-1-(phenylmethyl)-1H-pyrazolo[3,4-b]pyridine-4-carboxylate is a complex organic compound characterized by its unique pyrazolo-pyridine structure, which incorporates both a cyclopropyl group and an ethyl ester functionality. This compound features a bicyclic framework that contributes to its potential biological activity, making it of interest in medicinal chemistry. The presence of the phenylmethyl group enhances its lipophilicity, potentially influencing its pharmacokinetic properties. The oxo group and the carboxylate moiety suggest possible reactivity and interactions with biological targets. Its molecular structure indicates that it may exhibit specific stereochemistry, which can affect its binding affinity and selectivity for various receptors or enzymes. As with many compounds in this class, it may possess properties such as anti-inflammatory, analgesic, or neuroprotective effects, although specific biological activities would require empirical investigation. Overall, this compound exemplifies the complexity and diversity of synthetic organic molecules in drug discovery.

Formula: C₁₉H₁₉N₃O₃

InChI: InChI=1S/C19H19N3O3/c1-2-25-19(24)14-10-15(23)20-18-16(14)17(13-8-9-13)21-22(18)11-12-6-4-3-5-7-12/h3-7,10,13H,2,8-9,11H2,1H3,(H,20,23)

InChI key: InChIKey=BINXYRNWCPKJRC-UHFFFAOYSA-N

SMILES: C(OCC)(=O)C=1C=2C(=NN(CC3=CC=CC=C3)C2NC(=O)C1)C4CC4

Synonyms:

• 1H-Pyrazolo[3,4-b]pyridine-4-carboxylic acid, 3-cyclopropyl-6,7-dihydro-6-oxo-1-(phenylmethyl)-, ethyl ester
• Ethyl 3-cyclopropyl-6,7-dihydro-6-oxo-1-(phenylmethyl)-1H-pyrazolo[3,4-b]pyridine-4-carboxylate