CAS 1160246-20-7

7-(Difluoromethyl)pyrazolo[1,5-a]pyrimidine-6-carboxylic acid

Description:

7-(Difluoromethyl)pyrazolo[1,5-a]pyrimidine-6-carboxylic acid is a heterocyclic organic compound characterized by its unique pyrazolo-pyrimidine structure, which incorporates a difluoromethyl group and a carboxylic acid functional group. This compound typically exhibits properties associated with both aromatic and aliphatic systems, contributing to its potential reactivity and interactions. The presence of the difluoromethyl group enhances lipophilicity and may influence biological activity, making it of interest in medicinal chemistry. The carboxylic acid moiety can participate in hydrogen bonding and may affect solubility and reactivity in various chemical environments. Additionally, the compound's structure suggests potential applications in drug development, particularly in targeting specific biological pathways. Its synthesis and characterization would involve standard organic chemistry techniques, and its stability and reactivity would be influenced by the electronic effects of the difluoromethyl and carboxylic acid groups. Overall, this compound represents a valuable scaffold for further exploration in pharmaceutical research and development.

Formula: C₈H₅F₂N₃O₂

InChI: InChI=1S/C8H5F2N3O2/c9-7(10)6-4(8(14)15)3-11-5-1-2-12-13(5)6/h1-3,7H,(H,14,15)

InChI key: InChIKey=DHJIMIJRRHBMOJ-UHFFFAOYSA-N

SMILES: C(F)(F)C=1N2C(N=CC1C(O)=O)=CC=N2

Synonyms:

• Pyrazolo[1,5-a]pyrimidine-6-carboxylic acid, 7-(difluoromethyl)-
• 7-(Difluoromethyl)pyrazolo[1,5-a]pyrimidine-6-carboxylic acid

7-(Difluoromethyl)pyrazolo[1,5-a]pyrimidine-6-carboxylic acid

CAS: 1160246-20-7

Versatile small molecule scaffold

Formula: C₈H₅F₂N₃O₂

Purity: Min. 95%

Molecular weight: 213.14 g/mol

Ref: 3D-KWB24620