CymitQuimica logo

CAS 1160246-37-6

:

Ethyl 7-(difluoromethyl)-2-methylpyrazolo[1,5-a]pyrimidine-6-carboxylate

Description:
Ethyl 7-(difluoromethyl)-2-methylpyrazolo[1,5-a]pyrimidine-6-carboxylate is a chemical compound characterized by its unique pyrazolo-pyrimidine structure, which incorporates both a difluoromethyl group and an ethyl ester functional group. This compound typically exhibits properties associated with heterocyclic compounds, including potential biological activity due to its structural motifs. The presence of the difluoromethyl group may enhance lipophilicity and influence the compound's reactivity and interaction with biological targets. Ethyl esters generally have moderate volatility and can participate in various chemical reactions, such as hydrolysis. The compound's molecular structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals targeting specific biological pathways. Its synthesis and characterization would involve standard organic chemistry techniques, and it may be of interest in research related to drug discovery or agrochemicals. As with many such compounds, safety and handling precautions should be observed due to potential toxicity or reactivity.
Formula:C11H11F2N3O2
InChI:InChI=1S/C11H11F2N3O2/c1-3-18-11(17)7-5-14-8-4-6(2)15-16(8)9(7)10(12)13/h4-5,10H,3H2,1-2H3
InChI key:InChIKey=JGCGQXZEFBUECR-UHFFFAOYSA-N
SMILES:C(F)(F)C=1N2C(N=CC1C(OCC)=O)=CC(C)=N2
Synonyms:
  • Pyrazolo[1,5-a]pyrimidine-6-carboxylic acid, 7-(difluoromethyl)-2-methyl-, ethyl ester
  • Ethyl 7-(difluoromethyl)-2-methylpyrazolo[1,5-a]pyrimidine-6-carboxylate
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.