CAS 1160246-42-3

Methyl 1-(1-methylethyl)-1H-pyrazolo[3,4-b]pyridine-4-carboxylate

Description:

Methyl 1-(1-methylethyl)-1H-pyrazolo[3,4-b]pyridine-4-carboxylate is a chemical compound characterized by its unique pyrazolo-pyridine structure, which incorporates both a pyrazole and a pyridine ring. This compound features a methyl ester functional group, contributing to its solubility and reactivity. The presence of the isopropyl group (1-methylethyl) enhances its lipophilicity, potentially influencing its biological activity and interaction with various targets. The compound is likely to exhibit properties typical of heterocyclic compounds, such as potential pharmacological activity, making it of interest in medicinal chemistry. Its molecular structure suggests it may participate in various chemical reactions, including esterification and nucleophilic substitutions. Additionally, the compound's stability and reactivity can be influenced by the electronic effects of the substituents on the rings. Overall, Methyl 1-(1-methylethyl)-1H-pyrazolo[3,4-b]pyridine-4-carboxylate represents a class of compounds that may have applications in drug development and other chemical synthesis processes.

Formula: C₁₁H₁₃N₃O₂

InChI: InChI=1S/C11H13N3O2/c1-7(2)14-10-9(6-13-14)8(4-5-12-10)11(15)16-3/h4-7H,1-3H3

InChI key: InChIKey=FKDKUVVZZGJRLZ-UHFFFAOYSA-N

SMILES: C(OC)(=O)C1=C2C(N(C(C)C)N=C2)=NC=C1

Synonyms:

• Methyl 1-(1-methylethyl)-1H-pyrazolo[3,4-b]pyridine-4-carboxylate
• 1H-Pyrazolo[3,4-b]pyridine-4-carboxylic acid, 1-(1-methylethyl)-, methyl ester