
CAS 1160246-74-1
:Phenylmethyl 7-oxo-2,6-diazaspiro[4.5]decane-2-carboxylate
Description:
Phenylmethyl 7-oxo-2,6-diazaspiro[4.5]decane-2-carboxylate, identified by its CAS number 1160246-74-1, is a chemical compound characterized by its unique spirocyclic structure, which includes a diaza (two nitrogen atoms) framework. This compound features a phenylmethyl group, contributing to its aromatic properties, and a carboxylate functional group, which can influence its reactivity and solubility. The presence of the 7-oxo group indicates a ketone functionality, which may play a role in its biological activity or chemical reactivity. The spirocyclic nature of the molecule suggests potential conformational rigidity, which can affect its interactions with biological targets. Such compounds often exhibit interesting pharmacological properties, making them of interest in medicinal chemistry. However, specific details regarding its physical properties, such as melting point, boiling point, and solubility, as well as its biological activity, would require further investigation or experimental data. Overall, this compound represents a complex structure that may have applications in various fields, including pharmaceuticals and organic synthesis.
Formula:C16H20N2O3
InChI:InChI=1S/C16H20N2O3/c19-14-7-4-8-16(17-14)9-10-18(12-16)15(20)21-11-13-5-2-1-3-6-13/h1-3,5-6H,4,7-12H2,(H,17,19)
InChI key:InChIKey=KBVZXTSTUKGUBY-UHFFFAOYSA-N
SMILES:C(OCC1=CC=CC=C1)(=O)N2CC3(CC2)NC(=O)CCC3
Synonyms:- Phenylmethyl 7-oxo-2,6-diazaspiro[4.5]decane-2-carboxylate
- 2,6-Diazaspiro[4.5]decane-2-carboxylic acid, 7-oxo-, phenylmethyl ester
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
Benzyl 7-oxo-2,6-diazaspiro-[4.5]decane-2-carboxylate
CAS:Benzyl 7-oxo-2,6-diazaspiro-[4.5]decane-2-carboxylate is a potent inhibitor of protein interactions and an activator of ligand binding. It is used as a research tool in the study of receptor and ion channel function. Benzyl 7-oxo-2,6-diazaspiro-[4.5]decane-2-carboxylate has been shown to inhibit the activity of various proteins by binding to their active sites, including peptidases and proteases such as cathepsin D, elastase, collagenase, and trypsin. This compound also binds to the extracellular domains of cell surface receptors such as erythropoietin receptor (EpoR) and growth hormone receptor (GHR). The affinity for these receptors can be controlled by changing the length of the alkyl chain between benzene rings. Benzyl 7-oxoFormula:C16H20N2O3Purity:Min. 95%Molecular weight:288.34 g/mol

