CymitQuimica logo

CAS 1160246-82-1

:

8-(1,1-Dimethylethyl) 3-oxo-2,8-diazaspiro[4.5]decane-4,8-dicarboxylate

Description:
The chemical substance known as 8-(1,1-Dimethylethyl) 3-oxo-2,8-diazaspiro[4.5]decane-4,8-dicarboxylate, with the CAS number 1160246-82-1, is a complex organic compound characterized by its spirocyclic structure, which features a combination of nitrogen and carbon atoms. This compound contains two carboxylate functional groups, contributing to its potential acidity and reactivity. The presence of the 1,1-dimethylethyl group indicates steric hindrance, which may influence the compound's reactivity and interactions with other molecules. The oxo group suggests the presence of a carbonyl functionality, which can participate in various chemical reactions, including nucleophilic attacks. The diazaspiro framework adds to the compound's structural complexity, potentially affecting its biological activity and solubility. Overall, this substance may exhibit interesting properties that could be explored in various fields, including medicinal chemistry and materials science, although specific applications would depend on further research into its behavior and interactions.
Formula:C14H22N2O5
InChI:InChI=1S/C14H22N2O5/c1-13(2,3)21-12(20)16-6-4-14(5-7-16)8-15-10(17)9(14)11(18)19/h9H,4-8H2,1-3H3,(H,15,17)(H,18,19)
InChI key:InChIKey=IKFQZKDDLHPKAY-UHFFFAOYSA-N
SMILES:C(O)(=O)C1C2(CCN(C(OC(C)(C)C)=O)CC2)CNC1=O
Synonyms:
  • 2,8-Diazaspiro[4.5]decane-4,8-dicarboxylic acid, 3-oxo-, 8-(1,1-dimethylethyl) ester
  • 8-(1,1-Dimethylethyl) 3-oxo-2,8-diazaspiro[4.5]decane-4,8-dicarboxylate
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.