CAS 1160246-98-9

9-(1,1-Dimethylethyl) 2-oxa-9-azaspiro[5.5]undecane-3,9-dicarboxylate

Description:

9-(1,1-Dimethylethyl) 2-oxa-9-azaspiro[5.5]undecane-3,9-dicarboxylate, with the CAS number 1160246-98-9, is a chemical compound characterized by its unique spirocyclic structure, which includes both an oxo and an azaspiro moiety. This compound features a tert-butyl group, contributing to its steric bulk and potentially influencing its reactivity and solubility. The presence of two carboxylate groups suggests that it may exhibit acidic properties, allowing for potential interactions in various chemical environments. The spiro structure can impart rigidity to the molecule, which may affect its conformational dynamics and interactions with biological targets. Additionally, the compound may have applications in medicinal chemistry or materials science, depending on its specific properties and reactivity. As with many organic compounds, its behavior in solution, stability under various conditions, and potential biological activity would be of interest for further study. Overall, this compound exemplifies the complexity and diversity of organic molecules in chemical research.

Formula: C₁₅H₂₅NO₅

InChI: InChI=1S/C15H25NO5/c1-14(2,3)21-13(19)16-8-6-15(7-9-16)5-4-11(12(17)18)20-10-15/h11H,4-10H2,1-3H3,(H,17,18)

InChI key: InChIKey=ITMBUXNOUOBFFK-UHFFFAOYSA-N

SMILES: C(OC(C)(C)C)(=O)N1CCC2(CC1)CCC(C(O)=O)OC2

Synonyms:

• 9-(1,1-Dimethylethyl) 2-oxa-9-azaspiro[5.5]undecane-3,9-dicarboxylate
• 2-Oxa-9-azaspiro[5.5]undecane-3,9-dicarboxylic acid, 9-(1,1-dimethylethyl) ester

9-(tert-Butoxycarbonyl)-2-oxa-9-azaspiro[5.5]undecane-3-carboxylic acid

CAS: 1160246-98-9

Versatile small molecule scaffold

Formula: C₁₅H₂₅NO₅

Purity: Min. 95%

Molecular weight: 299.36 g/mol

Ref: 3D-KWB24698