CAS 1160247-19-7

Phenylmethyl 8-oxo-3,7-diazaspiro[5.6]dodecane-3-carboxylate

Description:

Phenylmethyl 8-oxo-3,7-diazaspiro[5.6]dodecane-3-carboxylate is a chemical compound characterized by its unique spirocyclic structure, which includes a bicyclic framework featuring nitrogen atoms. The presence of the 8-oxo group indicates a ketone functionality, contributing to its reactivity and potential biological activity. The compound also contains a carboxylate group, which can influence its solubility and interaction with biological systems. Its phenylmethyl substituent suggests potential aromatic interactions, which may enhance its binding properties in various applications. This compound is of interest in medicinal chemistry due to its structural complexity and potential pharmacological properties. The diazaspiro configuration may impart unique stereochemical characteristics, affecting its behavior in biological systems. Overall, the combination of these functional groups and structural features makes it a candidate for further investigation in drug development and other chemical applications.

Formula: C₁₈H₂₄N₂O₃

InChI: InChI=1S/C18H24N2O3/c21-16-8-4-5-9-18(19-16)10-12-20(13-11-18)17(22)23-14-15-6-2-1-3-7-15/h1-3,6-7H,4-5,8-14H2,(H,19,21)

InChI key: InChIKey=DZRQAACZBOUAOD-UHFFFAOYSA-N

SMILES: O=C1NC2(CCN(C(OCC3=CC=CC=C3)=O)CC2)CCCC1

Synonyms:

• Phenylmethyl 8-oxo-3,7-diazaspiro[5.6]dodecane-3-carboxylate
• 3,7-Diazaspiro[5.6]dodecane-3-carboxylic acid, 8-oxo-, phenylmethyl ester